C14H15BrN2O3 — CID 174786700
[1-(3-bromophenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propan-2-yl] formate (PubChem CID 174786700) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is [1-(3-bromophenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propan-2-yl] formate.
| Compound Name | [1-(3-bromophenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propan-2-yl] formate |
|---|---|
| PubChem CID | 174786700 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [1-(3-bromophenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propan-2-yl] formate |
| SMILES | O=COC(Cc1cccc(Br)c1)Cc1cc(CO)[nH]n1 |
| InChI | InChI=1S/C14H15BrN2O3/c15-11-3-1-2-10(4-11)5-14(20-9-19)7-12-6-13(8-18)17-16-12/h1-4,6,9,14,18H,5,7-8H2,(H,16,17) |
| InChIKey | YUYBSKULDIUJEI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|