C16H14BrN3O2 — CID 175298956
[[5-(aminomethyl)-2H-indazol-3-yl]-(3-bromophenyl)methyl] formate (PubChem CID 175298956) has the molecular formula C16H14BrN3O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is [[5-(aminomethyl)-2H-indazol-3-yl]-(3-bromophenyl)methyl] formate.
| Compound Name | [[5-(aminomethyl)-2H-indazol-3-yl]-(3-bromophenyl)methyl] formate |
|---|---|
| PubChem CID | 175298956 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [[5-(aminomethyl)-2H-indazol-3-yl]-(3-bromophenyl)methyl] formate |
| SMILES | NCc1ccc2n[nH]c(C(OC=O)c3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C16H14BrN3O2/c17-12-3-1-2-11(7-12)16(22-9-21)15-13-6-10(8-18)4-5-14(13)19-20-15/h1-7,9,16H,8,18H2,(H,19,20) |
| InChIKey | CHVXFGYUZCYINF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|