C20H20BrN3O3 — CID 174800583
[(3-bromophenyl)-[5-[(3-hydroxypyrrolidin-1-yl)methyl]-2H-indazol-3-yl]methyl] formate (PubChem CID 174800583) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is [(3-bromophenyl)-[5-[(3-hydroxypyrrolidin-1-yl)methyl]-2H-indazol-3-yl]methyl] formate.
| Compound Name | [(3-bromophenyl)-[5-[(3-hydroxypyrrolidin-1-yl)methyl]-2H-indazol-3-yl]methyl] formate |
|---|---|
| PubChem CID | 174800583 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [(3-bromophenyl)-[5-[(3-hydroxypyrrolidin-1-yl)methyl]-2H-indazol-3-yl]methyl] formate |
| SMILES | O=COC(c1cccc(Br)c1)c1[nH]nc2ccc(CN3CCC(O)C3)cc12 |
| InChI | InChI=1S/C20H20BrN3O3/c21-15-3-1-2-14(9-15)20(27-12-25)19-17-8-13(4-5-18(17)22-23-19)10-24-7-6-16(26)11-24/h1-5,8-9,12,16,20,26H,6-7,10-11H2,(H,22,23) |
| InChIKey | CKAFVIUXMHERQG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|