About magnesium;(3-bromophenyl)methanamine;dibromide
magnesium;(3-bromophenyl)methanamine;dibromide (PubChem CID 174355920) has the molecular formula C7H8Br3MgN
and a molecular weight of 370.17 g/mol. Its IUPAC name is magnesium;(3-bromophenyl)methanamine;dibromide.
Molecular Properties
| Compound Name | magnesium;(3-bromophenyl)methanamine;dibromide |
| PubChem CID | 174355920 |
| Molecular Formula | C7H8Br3MgN |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 366.81 |
| IUPAC Name | magnesium;(3-bromophenyl)methanamine;dibromide |
| SMILES | NCc1cccc(Br)c1.[Br-].[Br-].[Mg+2] |
| InChI | InChI=1S/C7H8BrN.2BrH.Mg/c8-7-3-1-2-6(4-7)5-9;;;/h1-4H,5,9H2;2*1H;/q;;;+2/p-2 |
| InChIKey | AZLTYYIUBZRRQN-UHFFFAOYSA-L |
| XLogP | -4.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;(3-bromophenyl)methanamine;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(3-bromophenyl)methanamine;dibromide?
The IUPAC name of magnesium;(3-bromophenyl)methanamine;dibromide (CID 174355920) is magnesium;(3-bromophenyl)methanamine;dibromide.
What is the SMILES notation for magnesium;(3-bromophenyl)methanamine;dibromide?
The canonical SMILES for magnesium;(3-bromophenyl)methanamine;dibromide is NCc1cccc(Br)c1.[Br-].[Br-].[Mg+2].
What is the InChIKey of magnesium;(3-bromophenyl)methanamine;dibromide?
The InChIKey is AZLTYYIUBZRRQN-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8BrN.2BrH.Mg/c8-7-3-1-2-6(4-7)5-9;;;/h1-4H,5,9H2;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;(3-bromophenyl)methanamine;dibromide?
magnesium;(3-bromophenyl)methanamine;dibromide has a molecular weight of 370.17 g/mol, XLogP of -4.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(3-bromophenyl)methanamine;dibromide is sourced from PubChem (CID 174355920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).