C19H23BrO2 — CID 176559935
3-(3-bromophenyl)-2-(2,3-dimethylphenyl)propanal;methoxymethane (PubChem CID 176559935) has the molecular formula C19H23BrO2 and a molecular weight of 363.30 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2-(2,3-dimethylphenyl)propanal;methoxymethane.
| Compound Name | 3-(3-bromophenyl)-2-(2,3-dimethylphenyl)propanal;methoxymethane |
|---|---|
| PubChem CID | 176559935 |
| Molecular Formula | C19H23BrO2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 3-(3-bromophenyl)-2-(2,3-dimethylphenyl)propanal;methoxymethane |
| SMILES | COC.Cc1cccc(C(C=O)Cc2cccc(Br)c2)c1C |
| InChI | InChI=1S/C17H17BrO.C2H6O/c1-12-5-3-8-17(13(12)2)15(11-19)9-14-6-4-7-16(18)10-14;1-3-2/h3-8,10-11,15H,9H2,1-2H3;1-2H3 |
| InChIKey | HVKDJBRWPHABOM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|