C11H11BrN2S — CID 82054774
[5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]methanamine (PubChem CID 82054774) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is [5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]methanamine.
| Compound Name | [5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 82054774 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | [5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]methanamine |
| SMILES | NCc1ncc(Cc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C11H11BrN2S/c12-9-3-1-2-8(4-9)5-10-7-14-11(6-13)15-10/h1-4,7H,5-6,13H2 |
| InChIKey | HQUSVCHLOLHUHP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |