C10H9BrN2S — CID 83851616
[5-(4-bromophenyl)-1,3-thiazol-2-yl]methanamine (PubChem CID 83851616) has the molecular formula C10H9BrN2S and a molecular weight of 269.17 g/mol. Its IUPAC name is [5-(4-bromophenyl)-1,3-thiazol-2-yl]methanamine.
| Compound Name | [5-(4-bromophenyl)-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 83851616 |
| Molecular Formula | C10H9BrN2S |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | [5-(4-bromophenyl)-1,3-thiazol-2-yl]methanamine |
| SMILES | NCc1ncc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C10H9BrN2S/c11-8-3-1-7(2-4-8)9-6-13-10(5-12)14-9/h1-4,6H,5,12H2 |
| InChIKey | XMOUAWWTMRSKBR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |