C16H19BrN2S — CID 53272842
N-[[5-(4-bromophenyl)-1,3-thiazol-2-yl]methyl]cyclohexanamine (PubChem CID 53272842) has the molecular formula C16H19BrN2S and a molecular weight of 351.31 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)-1,3-thiazol-2-yl]methyl]cyclohexanamine.
| Compound Name | N-[[5-(4-bromophenyl)-1,3-thiazol-2-yl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 53272842 |
| Molecular Formula | C16H19BrN2S |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-[[5-(4-bromophenyl)-1,3-thiazol-2-yl]methyl]cyclohexanamine |
| SMILES | Brc1ccc(-c2cnc(CNC3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C16H19BrN2S/c17-13-8-6-12(7-9-13)15-10-19-16(20-15)11-18-14-4-2-1-3-5-14/h6-10,14,18H,1-5,11H2 |
| InChIKey | PTCMMJWNEOAATL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |