C12H20N2S — CID 115655830
N-[(5-methyl-1,3-thiazol-2-yl)methyl]cycloheptanamine (PubChem CID 115655830) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is N-[(5-methyl-1,3-thiazol-2-yl)methyl]cycloheptanamine.
| Compound Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]cycloheptanamine |
|---|---|
| PubChem CID | 115655830 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]cycloheptanamine |
| SMILES | Cc1cnc(CNC2CCCCCC2)s1 |
| InChI | InChI=1S/C12H20N2S/c1-10-8-14-12(15-10)9-13-11-6-4-2-3-5-7-11/h8,11,13H,2-7,9H2,1H3 |
| InChIKey | ZBTUUBZRNVBXLR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |