C11H18N2OS — CID 103894937
N-[(5-methyl-1,3-thiazol-2-yl)methyl]oxepan-4-amine (PubChem CID 103894937) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-[(5-methyl-1,3-thiazol-2-yl)methyl]oxepan-4-amine.
| Compound Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]oxepan-4-amine |
|---|---|
| PubChem CID | 103894937 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]oxepan-4-amine |
| SMILES | Cc1cnc(CNC2CCCOCC2)s1 |
| InChI | InChI=1S/C11H18N2OS/c1-9-7-13-11(15-9)8-12-10-3-2-5-14-6-4-10/h7,10,12H,2-6,8H2,1H3 |
| InChIKey | KGVKYRZZNBABDU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |