C9H13BrN2OS — CID 130646271
(3S)-N-[(5-bromo-1,3-thiazol-2-yl)methyl]oxan-3-amine (PubChem CID 130646271) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is (3S)-N-[(5-bromo-1,3-thiazol-2-yl)methyl]oxan-3-amine.
| Compound Name | (3S)-N-[(5-bromo-1,3-thiazol-2-yl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 130646271 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (3S)-N-[(5-bromo-1,3-thiazol-2-yl)methyl]oxan-3-amine |
| SMILES | Brc1cnc(CN[C@H]2CCCOC2)s1 |
| InChI | InChI=1S/C9H13BrN2OS/c10-8-4-12-9(14-8)5-11-7-2-1-3-13-6-7/h4,7,11H,1-3,5-6H2/t7-/m0/s1 |
| InChIKey | NOTSMQALMDAREI-ZETCQYMHSA-N |
| XLogP | 2.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |