C11H16N2OS — CID 115757871
N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]oxolan-3-amine (PubChem CID 115757871) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]oxolan-3-amine.
| Compound Name | N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 115757871 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]oxolan-3-amine |
| SMILES | c1nc(C2CC2)sc1CNC1CCOC1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-8(1)11-13-6-10(15-11)5-12-9-3-4-14-7-9/h6,8-9,12H,1-5,7H2 |
| InChIKey | YCXLDAUSQKJTHL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |