About 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine
1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine (PubChem CID 61281926) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine.
Analyze 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine?
The IUPAC name of 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine (CID 61281926) is 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine?
The canonical SMILES for 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine is CNCc1cnc(C2CCCC2)s1.
What is the InChIKey of 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine?
The InChIKey is YMXRFMKCKZLRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-11-6-9-7-12-10(13-9)8-4-2-3-5-8/h7-8,11H,2-6H2,1H3.
What are the key properties of 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine?
1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine has a molecular weight of 196.32 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopentyl-1,3-thiazol-5-yl)-N-methylmethanamine is sourced from PubChem (CID 61281926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).