C12H20N2OS — CID 103854799
(3R)-3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]butan-1-ol (PubChem CID 103854799) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is (3R)-3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]butan-1-ol.
| Compound Name | (3R)-3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 103854799 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (3R)-3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]butan-1-ol |
| SMILES | C[C@H](CCO)NCc1cnc(C2CCC2)s1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(5-6-15)13-7-11-8-14-12(16-11)10-3-2-4-10/h8-10,13,15H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | FEJCNXKKIOSISY-SECBINFHSA-N |
| XLogP | 2.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |