About 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine
2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine (PubChem CID 115089963) has the molecular formula C11H18N2O2S2
and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine |
| PubChem CID | 115089963 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine |
| SMILES | CNCCc1cnc(C2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-12-5-2-10-8-13-11(16-10)9-3-6-17(14,15)7-4-9/h8-9,12H,2-7H2,1H3 |
| InChIKey | CZOHTOWQHUFPDV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine?
The IUPAC name of 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine (CID 115089963) is 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine.
What is the SMILES notation for 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine?
The canonical SMILES for 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine is CNCCc1cnc(C2CCS(=O)(=O)CC2)s1.
What is the InChIKey of 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine?
The InChIKey is CZOHTOWQHUFPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S2/c1-12-5-2-10-8-13-11(16-10)9-3-6-17(14,15)7-4-9/h8-9,12H,2-7H2,1H3.
What are the key properties of 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine?
2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine has a molecular weight of 274.41 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,1-dioxothian-4-yl)-1,3-thiazol-5-yl]-N-methylethanamine is sourced from PubChem (CID 115089963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).