C15H17ClN2S — CID 53271603
N-[[5-(3-chlorophenyl)-1,3-thiazol-2-yl]methyl]cyclopentanamine (PubChem CID 53271603) has the molecular formula C15H17ClN2S and a molecular weight of 292.83 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)-1,3-thiazol-2-yl]methyl]cyclopentanamine.
| Compound Name | N-[[5-(3-chlorophenyl)-1,3-thiazol-2-yl]methyl]cyclopentanamine |
|---|---|
| PubChem CID | 53271603 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-[[5-(3-chlorophenyl)-1,3-thiazol-2-yl]methyl]cyclopentanamine |
| SMILES | Clc1cccc(-c2cnc(CNC3CCCC3)s2)c1 |
| InChI | InChI=1S/C15H17ClN2S/c16-12-5-3-4-11(8-12)14-9-18-15(19-14)10-17-13-6-1-2-7-13/h3-5,8-9,13,17H,1-2,6-7,10H2 |
| InChIKey | DPFIEWWWJLGUNN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |