C11H11ClN2S — CID 61280552
[2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]methanamine (PubChem CID 61280552) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 61280552 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | [2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C11H11ClN2S/c12-9-3-1-2-8(4-9)5-11-14-7-10(6-13)15-11/h1-4,7H,5-6,13H2 |
| InChIKey | LMXUFKWCLRDDHX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |