C20H18Cl2N4O2 — CID 66629043
5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-amine (PubChem CID 66629043) has the molecular formula C20H18Cl2N4O2 and a molecular weight of 417.30 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-amine.
| Compound Name | 5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 66629043 |
| Molecular Formula | C20H18Cl2N4O2 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-amine |
| SMILES | Nc1ncc(Cc2cccc(Cl)c2)o1.Nc1ncc(Cc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/2C10H9ClN2O/c2*11-8-3-1-2-7(4-8)5-9-6-13-10(12)14-9/h2*1-4,6H,5H2,(H2,12,13) |
| InChIKey | YZIZCUAGJBKOPY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |