C15H12ClN3O — CID 19542259
4-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 19542259) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 4-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]aniline.
| Compound Name | 4-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 19542259 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nnc(Cc3cccc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C15H12ClN3O/c16-12-3-1-2-10(8-12)9-14-18-19-15(20-14)11-4-6-13(17)7-5-11/h1-8H,9,17H2 |
| InChIKey | KGOCCIVWHQTYAI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|