C13H12ClNOS — CID 115091371
1-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]propan-2-one (PubChem CID 115091371) has the molecular formula C13H12ClNOS and a molecular weight of 265.77 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]propan-2-one.
| Compound Name | 1-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]propan-2-one |
|---|---|
| PubChem CID | 115091371 |
| Molecular Formula | C13H12ClNOS |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-5-yl]propan-2-one |
| SMILES | CC(=O)Cc1cnc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C13H12ClNOS/c1-9(16)5-12-8-15-13(17-12)7-10-3-2-4-11(14)6-10/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | VNXJLHXQMVYPOY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |