C12H12N2O2 — CID 135483738
4-benzyl-2-methoxy-1H-pyrimidin-6-one (PubChem CID 135483738) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-benzyl-2-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-benzyl-2-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135483738 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-benzyl-2-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1nc(Cc2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H12N2O2/c1-16-12-13-10(8-11(15)14-12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,14,15) |
| InChIKey | XIEWHXKGCLBFSI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |