C22H26N4O — CID 146512786
4-benzyl-2-[[(2R)-2-(dimethylamino)-3-phenylpropyl]amino]-1H-pyrimidin-6-one (PubChem CID 146512786) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-benzyl-2-[[(2R)-2-(dimethylamino)-3-phenylpropyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 4-benzyl-2-[[(2R)-2-(dimethylamino)-3-phenylpropyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146512786 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-benzyl-2-[[(2R)-2-(dimethylamino)-3-phenylpropyl]amino]-1H-pyrimidin-6-one |
| SMILES | CN(C)[C@@H](CNc1nc(Cc2ccccc2)cc(=O)[nH]1)Cc1ccccc1 |
| InChI | InChI=1S/C22H26N4O/c1-26(2)20(14-18-11-7-4-8-12-18)16-23-22-24-19(15-21(27)25-22)13-17-9-5-3-6-10-17/h3-12,15,20H,13-14,16H2,1-2H3,(H2,23,24,25,27)/t20-/m1/s1 |
| InChIKey | MSYYSBYAMHMTPK-HXUWFJFHSA-N |
| XLogP | 2.95 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |