C13H17ClN2 — CID 142003452
2-chloro-3,6,7-trimethylquinoxaline;ethane (PubChem CID 142003452) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 2-chloro-3,6,7-trimethylquinoxaline;ethane.
| Compound Name | 2-chloro-3,6,7-trimethylquinoxaline;ethane |
|---|---|
| PubChem CID | 142003452 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-chloro-3,6,7-trimethylquinoxaline;ethane |
| SMILES | CC.Cc1cc2nc(C)c(Cl)nc2cc1C |
| InChI | InChI=1S/C11H11ClN2.C2H6/c1-6-4-9-10(5-7(6)2)14-11(12)8(3)13-9;1-2/h4-5H,1-3H3;1-2H3 |
| InChIKey | VPBTWBGZUFPYLO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |