3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid

C11H9ClN2O2 — CID 21491294

IUPAC3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid
SMILESCc1cc2nc(Cl)c(C(=O)O)nc2cc1C
InChIInChI=1S/C11H9ClN2O2/c1-5-3-7-8(4-6(5)2)14-10(12)9(13-7)11(15)16/h3-4H,1-2H3,(H,15,16)
InChIKeyHMKLFXHDMXNAOD-UHFFFAOYSA-N
MW236.66 g/mol
LogP2.60
Rot. Bonds1

About 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid

3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid (PubChem CID 21491294) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid.

Molecular Properties

Compound Name3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid
PubChem CID21491294
Molecular FormulaC11H9ClN2O2
Molecular Weight236.66 g/mol
Exact Mass236.04
IUPAC Name3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid
SMILESCc1cc2nc(Cl)c(C(=O)O)nc2cc1C
InChIInChI=1S/C11H9ClN2O2/c1-5-3-7-8(4-6(5)2)14-10(12)9(13-7)11(15)16/h3-4H,1-2H3,(H,15,16)
InChIKeyHMKLFXHDMXNAOD-UHFFFAOYSA-N
XLogP2.60
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.66
LogP ≤ 52.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid?
The IUPAC name of 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid (CID 21491294) is 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid.
What is the SMILES notation for 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid?
The canonical SMILES for 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid is Cc1cc2nc(Cl)c(C(=O)O)nc2cc1C.
What is the InChIKey of 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid?
The InChIKey is HMKLFXHDMXNAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O2/c1-5-3-7-8(4-6(5)2)14-10(12)9(13-7)11(15)16/h3-4H,1-2H3,(H,15,16).
What are the key properties of 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid?
3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid has a molecular weight of 236.66 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6,7-dimethylquinoxaline-2-carboxylic acid is sourced from PubChem (CID 21491294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).