About ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate
ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate (PubChem CID 13029756) has the molecular formula C14H16N4O3
and a molecular weight of 288.31 g/mol. Its IUPAC name is ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate |
| PubChem CID | 13029756 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1nc2cc(C)c(C)cc2nc1C(N)=O |
| InChI | InChI=1S/C14H16N4O3/c1-4-21-14(20)18-13-11(12(15)19)16-9-5-7(2)8(3)6-10(9)17-13/h5-6H,4H2,1-3H3,(H2,15,19)(H,17,18,20) |
| InChIKey | WYUCVZSGVCTXHY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate?
The IUPAC name of ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate (CID 13029756) is ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate.
What is the SMILES notation for ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate?
The canonical SMILES for ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate is CCOC(=O)Nc1nc2cc(C)c(C)cc2nc1C(N)=O.
What is the InChIKey of ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate?
The InChIKey is WYUCVZSGVCTXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O3/c1-4-21-14(20)18-13-11(12(15)19)16-9-5-7(2)8(3)6-10(9)17-13/h5-6H,4H2,1-3H3,(H2,15,19)(H,17,18,20).
What are the key properties of ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate?
ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate has a molecular weight of 288.31 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(3-carbamoyl-6,7-dimethylquinoxalin-2-yl)carbamate is sourced from PubChem (CID 13029756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).