C12H10F3N3O3 — CID 142709307
ethyl N-(5,6,7-trifluoro-3-methoxyquinoxalin-2-yl)carbamate (PubChem CID 142709307) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is ethyl N-(5,6,7-trifluoro-3-methoxyquinoxalin-2-yl)carbamate.
| Compound Name | ethyl N-(5,6,7-trifluoro-3-methoxyquinoxalin-2-yl)carbamate |
|---|---|
| PubChem CID | 142709307 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | ethyl N-(5,6,7-trifluoro-3-methoxyquinoxalin-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1nc2cc(F)c(F)c(F)c2nc1OC |
| InChI | InChI=1S/C12H10F3N3O3/c1-3-21-12(19)18-10-11(20-2)17-9-6(16-10)4-5(13)7(14)8(9)15/h4H,3H2,1-2H3,(H,16,18,19) |
| InChIKey | NWRCUTPBDCEPRO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|