C13H16N6O3 — CID 10852033
ethyl N-[2-[(5-carbamoyl-2H-triazol-4-yl)amino]-5-methylphenyl]carbamate (PubChem CID 10852033) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is ethyl N-[2-[(5-carbamoyl-2H-triazol-4-yl)amino]-5-methylphenyl]carbamate.
| Compound Name | ethyl N-[2-[(5-carbamoyl-2H-triazol-4-yl)amino]-5-methylphenyl]carbamate |
|---|---|
| PubChem CID | 10852033 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | ethyl N-[2-[(5-carbamoyl-2H-triazol-4-yl)amino]-5-methylphenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(C)ccc1Nc1n[nH]nc1C(N)=O |
| InChI | InChI=1S/C13H16N6O3/c1-3-22-13(21)16-9-6-7(2)4-5-8(9)15-12-10(11(14)20)17-19-18-12/h4-6H,3H2,1-2H3,(H2,14,20)(H,16,21)(H2,15,17,18,19) |
| InChIKey | XEFBOKSVBLLCNP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |