C15H21NO2Si — CID 58475259
ethyl N-[4-methyl-2-(2-trimethylsilylethynyl)phenyl]carbamate (PubChem CID 58475259) has the molecular formula C15H21NO2Si and a molecular weight of 275.42 g/mol. Its IUPAC name is ethyl N-[4-methyl-2-(2-trimethylsilylethynyl)phenyl]carbamate.
| Compound Name | ethyl N-[4-methyl-2-(2-trimethylsilylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 58475259 |
| Molecular Formula | C15H21NO2Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | ethyl N-[4-methyl-2-(2-trimethylsilylethynyl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H21NO2Si/c1-6-18-15(17)16-14-8-7-12(2)11-13(14)9-10-19(3,4)5/h7-8,11H,6H2,1-5H3,(H,16,17) |
| InChIKey | XZWWPLSBGAPHRS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|