C15H19NO2Si — CID 141342772
N-[4-acetyl-2-(2-trimethylsilylethynyl)phenyl]acetamide (PubChem CID 141342772) has the molecular formula C15H19NO2Si and a molecular weight of 273.41 g/mol. Its IUPAC name is N-[4-acetyl-2-(2-trimethylsilylethynyl)phenyl]acetamide.
| Compound Name | N-[4-acetyl-2-(2-trimethylsilylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 141342772 |
| Molecular Formula | C15H19NO2Si |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[4-acetyl-2-(2-trimethylsilylethynyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(C)=O)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H19NO2Si/c1-11(17)13-6-7-15(16-12(2)18)14(10-13)8-9-19(3,4)5/h6-7,10H,1-5H3,(H,16,18) |
| InChIKey | BMJQPCWBPBKRRV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|