C16H24N2O3SSi — CID 66973773
N-[4-[2-(methylsulfamoyl)ethyl]-2-(2-trimethylsilylethynyl)phenyl]acetamide (PubChem CID 66973773) has the molecular formula C16H24N2O3SSi and a molecular weight of 352.53 g/mol. Its IUPAC name is N-[4-[2-(methylsulfamoyl)ethyl]-2-(2-trimethylsilylethynyl)phenyl]acetamide.
| Compound Name | N-[4-[2-(methylsulfamoyl)ethyl]-2-(2-trimethylsilylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 66973773 |
| Molecular Formula | C16H24N2O3SSi |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[4-[2-(methylsulfamoyl)ethyl]-2-(2-trimethylsilylethynyl)phenyl]acetamide |
| SMILES | CNS(=O)(=O)CCc1ccc(NC(C)=O)c(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C16H24N2O3SSi/c1-13(19)18-16-7-6-14(8-10-22(20,21)17-2)12-15(16)9-11-23(3,4)5/h6-7,12,17H,8,10H2,1-5H3,(H,18,19) |
| InChIKey | BKVCGEHVHPYKHP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|