C33H35N3O2 — CID 173478253
N-[2-[2-[6-[2-(2-acetamido-5-tert-butylphenyl)ethynyl]-2-pyridinyl]ethynyl]-4-tert-butylphenyl]acetamide (PubChem CID 173478253) has the molecular formula C33H35N3O2 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[2-[2-[6-[2-(2-acetamido-5-tert-butylphenyl)ethynyl]-2-pyridinyl]ethynyl]-4-tert-butylphenyl]acetamide.
| Compound Name | N-[2-[2-[6-[2-(2-acetamido-5-tert-butylphenyl)ethynyl]-2-pyridinyl]ethynyl]-4-tert-butylphenyl]acetamide |
|---|---|
| PubChem CID | 173478253 |
| Molecular Formula | C33H35N3O2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-[2-[2-[6-[2-(2-acetamido-5-tert-butylphenyl)ethynyl]-2-pyridinyl]ethynyl]-4-tert-butylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(C)(C)C)cc1C#Cc1cccc(C#Cc2cc(C(C)(C)C)ccc2NC(C)=O)n1 |
| InChI | InChI=1S/C33H35N3O2/c1-22(37)34-30-18-14-26(32(3,4)5)20-24(30)12-16-28-10-9-11-29(36-28)17-13-25-21-27(33(6,7)8)15-19-31(25)35-23(2)38/h9-11,14-15,18-21H,1-8H3,(H,34,37)(H,35,38) |
| InChIKey | TZCUSBVJZBPROQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|