C17H18Cl2N4O2 — CID 67030548
N-[6-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethynyl]-2-pyridinyl]acetamide;dihydrochloride (PubChem CID 67030548) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is N-[6-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethynyl]-2-pyridinyl]acetamide;dihydrochloride.
| Compound Name | N-[6-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethynyl]-2-pyridinyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 67030548 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-[6-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethynyl]-2-pyridinyl]acetamide;dihydrochloride |
| SMILES | CC(=O)Nc1cccc(C#Cc2ccc(CC(=O)NN)cc2)n1.Cl.Cl |
| InChI | InChI=1S/C17H16N4O2.2ClH/c1-12(22)19-16-4-2-3-15(20-16)10-9-13-5-7-14(8-6-13)11-17(23)21-18;;/h2-8H,11,18H2,1H3,(H,21,23)(H,19,20,22);2*1H |
| InChIKey | YYCNUJCSQVFNEI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|