C14H18N2O2 — CID 62677687
N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,2-dimethylbutanamide (PubChem CID 62677687) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,2-dimethylbutanamide.
| Compound Name | N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 62677687 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cccc(C#CCO)n1 |
| InChI | InChI=1S/C14H18N2O2/c1-4-14(2,3)13(18)16-12-9-5-7-11(15-12)8-6-10-17/h5,7,9,17H,4,10H2,1-3H3,(H,15,16,18) |
| InChIKey | LLKYJDRXDGKVDK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|