C10H12N2O5S2 — CID 82842780
N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82842780) has the molecular formula C10H12N2O5S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82842780 |
| Molecular Formula | C10H12N2O5S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1cccc(C#CCO)n1 |
| InChI | InChI=1S/C10H12N2O5S2/c1-18(14,15)8-19(16,17)12-10-6-2-4-9(11-10)5-3-7-13/h2,4,6,13H,7-8H2,1H3,(H,11,12) |
| InChIKey | JHGCTYBGTZKOCE-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|