C11H15N3O3S — CID 114811711
3-[6-(propan-2-ylsulfamoylamino)-2-pyridinyl]prop-2-yn-1-ol (PubChem CID 114811711) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-[6-(propan-2-ylsulfamoylamino)-2-pyridinyl]prop-2-yn-1-ol.
| Compound Name | 3-[6-(propan-2-ylsulfamoylamino)-2-pyridinyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114811711 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-[6-(propan-2-ylsulfamoylamino)-2-pyridinyl]prop-2-yn-1-ol |
| SMILES | CC(C)NS(=O)(=O)Nc1cccc(C#CCO)n1 |
| InChI | InChI=1S/C11H15N3O3S/c1-9(2)13-18(16,17)14-11-7-3-5-10(12-11)6-4-8-15/h3,5,7,9,13,15H,8H2,1-2H3,(H,12,14) |
| InChIKey | OHPFNEUIDCYNAU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|