C11H13N3O2 — CID 60814714
1-ethyl-3-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]urea (PubChem CID 60814714) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-ethyl-3-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]urea.
| Compound Name | 1-ethyl-3-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 60814714 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-ethyl-3-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]urea |
| SMILES | CCNC(=O)Nc1cccc(C#CCO)n1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-12-11(16)14-10-7-3-5-9(13-10)6-4-8-15/h3,5,7,15H,2,8H2,1H3,(H2,12,13,14,16) |
| InChIKey | ZLIATLSXUWXOJC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|