C13H9ClN2O2S — CID 62276510
5-chloro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]thiophene-2-carboxamide (PubChem CID 62276510) has the molecular formula C13H9ClN2O2S and a molecular weight of 292.75 g/mol. Its IUPAC name is 5-chloro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 62276510 |
| Molecular Formula | C13H9ClN2O2S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 5-chloro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(C#CCO)n1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H9ClN2O2S/c14-11-7-6-10(19-11)13(18)16-12-5-1-3-9(15-12)4-2-8-17/h1,3,5-7,17H,8H2,(H,15,16,18) |
| InChIKey | LCXGWZZOQHAYRV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|