C12H14N2O5S — CID 61457398
ethyl 2-[[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]acetate (PubChem CID 61457398) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is ethyl 2-[[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]acetate.
| Compound Name | ethyl 2-[[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 61457398 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | ethyl 2-[[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1cccc(C#CCO)n1 |
| InChI | InChI=1S/C12H14N2O5S/c1-2-19-12(16)9-20(17,18)14-11-7-3-5-10(13-11)6-4-8-15/h3,5,7,15H,2,8-9H2,1H3,(H,13,14) |
| InChIKey | QLKUPPLLSBNAOY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|