C9H8F2N2O4S — CID 54971386
3-[6-(difluoromethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid (PubChem CID 54971386) has the molecular formula C9H8F2N2O4S and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-[6-(difluoromethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-(difluoromethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54971386 |
| Molecular Formula | C9H8F2N2O4S |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 3-[6-(difluoromethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(NS(=O)(=O)C(F)F)n1 |
| InChI | InChI=1S/C9H8F2N2O4S/c10-9(11)18(16,17)13-7-3-1-2-6(12-7)4-5-8(14)15/h1-5,9H,(H,12,13)(H,14,15) |
| InChIKey | NTAHQEIKPYZVRW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|