C12H15N3O4S — CID 76906299
3-[6-(pyrrolidin-1-ylsulfonylamino)-2-pyridinyl]prop-2-enoic acid (PubChem CID 76906299) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[6-(pyrrolidin-1-ylsulfonylamino)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-(pyrrolidin-1-ylsulfonylamino)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906299 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-[6-(pyrrolidin-1-ylsulfonylamino)-2-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(NS(=O)(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C12H15N3O4S/c16-12(17)7-6-10-4-3-5-11(13-10)14-20(18,19)15-8-1-2-9-15/h3-7H,1-2,8-9H2,(H,13,14)(H,16,17) |
| InChIKey | WGAPVWDYUZGTJR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|