C12H17N3O4S — CID 114816709
(E)-3-[6-(2-methylpropylsulfamoylamino)-2-pyridinyl]prop-2-enoic acid (PubChem CID 114816709) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (E)-3-[6-(2-methylpropylsulfamoylamino)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(2-methylpropylsulfamoylamino)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114816709 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (E)-3-[6-(2-methylpropylsulfamoylamino)-2-pyridinyl]prop-2-enoic acid |
| SMILES | CC(C)CNS(=O)(=O)Nc1cccc(/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C12H17N3O4S/c1-9(2)8-13-20(18,19)15-11-5-3-4-10(14-11)6-7-12(16)17/h3-7,9,13H,8H2,1-2H3,(H,14,15)(H,16,17)/b7-6+ |
| InChIKey | JIWMTKFDPUIZLW-VOTSOKGWSA-N |
| XLogP | 1.08 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|