C8H9N3O4S — CID 114959594
(E)-3-[6-(sulfamoylamino)-2-pyridinyl]prop-2-enoic acid (PubChem CID 114959594) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is (E)-3-[6-(sulfamoylamino)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(sulfamoylamino)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114959594 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | (E)-3-[6-(sulfamoylamino)-2-pyridinyl]prop-2-enoic acid |
| SMILES | NS(=O)(=O)Nc1cccc(/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C8H9N3O4S/c9-16(14,15)11-7-3-1-2-6(10-7)4-5-8(12)13/h1-5H,(H,10,11)(H,12,13)(H2,9,14,15)/b5-4+ |
| InChIKey | ZIRYNNKICQYAPO-SNAWJCMRSA-N |
| XLogP | -0.21 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|