C11H11N3O4S — CID 77072873
3-[6-(1-cyanoethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid (PubChem CID 77072873) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 3-[6-(1-cyanoethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-(1-cyanoethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77072873 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-[6-(1-cyanoethylsulfonylamino)-2-pyridinyl]prop-2-enoic acid |
| SMILES | CC(C#N)S(=O)(=O)Nc1cccc(C=CC(=O)O)n1 |
| InChI | InChI=1S/C11H11N3O4S/c1-8(7-12)19(17,18)14-10-4-2-3-9(13-10)5-6-11(15)16/h2-6,8H,1H3,(H,13,14)(H,15,16) |
| InChIKey | CBPKJLKXNIAUTE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|