C12H12N4O4S — CID 77021109
3-[6-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]-2-pyridinyl]prop-2-enoic acid (PubChem CID 77021109) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 3-[6-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77021109 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-[6-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]-2-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cccc(C=CC(=O)O)n2)[nH]1 |
| InChI | InChI=1S/C12H12N4O4S/c1-8-13-7-11(14-8)21(19,20)16-10-4-2-3-9(15-10)5-6-12(17)18/h2-7H,1H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | FKRMKXHLCLGMOB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|