C12H18N4O4S — CID 91176008
4-[(6-methyl-2-pyridinyl)sulfamoyl]-1,4-diazepane-1-carboxylic acid (PubChem CID 91176008) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-[(6-methyl-2-pyridinyl)sulfamoyl]-1,4-diazepane-1-carboxylic acid.
| Compound Name | 4-[(6-methyl-2-pyridinyl)sulfamoyl]-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 91176008 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-[(6-methyl-2-pyridinyl)sulfamoyl]-1,4-diazepane-1-carboxylic acid |
| SMILES | Cc1cccc(NS(=O)(=O)N2CCCN(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C12H18N4O4S/c1-10-4-2-5-11(13-10)14-21(19,20)16-7-3-6-15(8-9-16)12(17)18/h2,4-5H,3,6-9H2,1H3,(H,13,14)(H,17,18) |
| InChIKey | MWLGBYRAPBGDEJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |