C16H20N4O4S — CID 69455568
ethyl 4-(quinolin-2-ylsulfamoyl)piperazine-1-carboxylate (PubChem CID 69455568) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is ethyl 4-(quinolin-2-ylsulfamoyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(quinolin-2-ylsulfamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69455568 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | ethyl 4-(quinolin-2-ylsulfamoyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)Nc2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C16H20N4O4S/c1-2-24-16(21)19-9-11-20(12-10-19)25(22,23)18-15-8-7-13-5-3-4-6-14(13)17-15/h3-8H,2,9-12H2,1H3,(H,17,18) |
| InChIKey | MEQHZVXXUYXNJA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |