C21H22ClN5O4S — CID 25036116
ethyl 4-[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]piperazine-1-carboxylate (PubChem CID 25036116) has the molecular formula C21H22ClN5O4S and a molecular weight of 475.96 g/mol. Its IUPAC name is ethyl 4-[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 25036116 |
| Molecular Formula | C21H22ClN5O4S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | ethyl 4-[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc3ccccc3nc2NS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H22ClN5O4S/c1-2-31-21(28)27-13-11-26(12-14-27)20-19(23-17-5-3-4-6-18(17)24-20)25-32(29,30)16-9-7-15(22)8-10-16/h3-10H,2,11-14H2,1H3,(H,23,25) |
| InChIKey | UNOOLWVETOIFIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |