C20H24N5O2S+ — CID 7392711
N-[3-(4-ethylpiperazin-4-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 7392711) has the molecular formula C20H24N5O2S+ and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-4-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-(4-ethylpiperazin-4-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 7392711 |
| Molecular Formula | C20H24N5O2S+ |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[3-(4-ethylpiperazin-4-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | CC[NH+]1CCN(c2nc3ccccc3nc2NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N5O2S/c1-2-24-12-14-25(15-13-24)20-19(21-17-10-6-7-11-18(17)22-20)23-28(26,27)16-8-4-3-5-9-16/h3-11H,2,12-15H2,1H3,(H,21,23)/p+1 |
| InChIKey | JJAFPWCQVSBYOA-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |