C20H32N6+2 — CID 3478937
2,3-bis(4-ethylpiperazin-4-ium-1-yl)quinoxaline (PubChem CID 3478937) has the molecular formula C20H32N6+2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 2,3-bis(4-ethylpiperazin-4-ium-1-yl)quinoxaline.
| Compound Name | 2,3-bis(4-ethylpiperazin-4-ium-1-yl)quinoxaline |
|---|---|
| PubChem CID | 3478937 |
| Molecular Formula | C20H32N6+2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 2,3-bis(4-ethylpiperazin-4-ium-1-yl)quinoxaline |
| SMILES | CC[NH+]1CCN(c2nc3ccccc3nc2N2CC[NH+](CC)CC2)CC1 |
| InChI | InChI=1S/C20H30N6/c1-3-23-9-13-25(14-10-23)19-20(26-15-11-24(4-2)12-16-26)22-18-8-6-5-7-17(18)21-19/h5-8H,3-4,9-16H2,1-2H3/p+2 |
| InChIKey | AUBGWPVZZMQJKL-UHFFFAOYSA-P |
| XLogP | -0.92 |
| TPSA | 41.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |