C12H13F3N2OSi — CID 59829966
2,2,2-trifluoro-N-[6-(2-trimethylsilylethynyl)-2-pyridinyl]acetamide (PubChem CID 59829966) has the molecular formula C12H13F3N2OSi and a molecular weight of 286.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[6-(2-trimethylsilylethynyl)-2-pyridinyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[6-(2-trimethylsilylethynyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59829966 |
| Molecular Formula | C12H13F3N2OSi |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[6-(2-trimethylsilylethynyl)-2-pyridinyl]acetamide |
| SMILES | C[Si](C)(C)C#Cc1cccc(NC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H13F3N2OSi/c1-19(2,3)8-7-9-5-4-6-10(16-9)17-11(18)12(13,14)15/h4-6H,1-3H3,(H,16,17,18) |
| InChIKey | LNUUHYZCLGFIOC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|